C15H9N3O3S2 — CID 159123971
(5Z)-5-[[5-(3H-pyrrolo[3,2-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 159123971) has the molecular formula C15H9N3O3S2 and a molecular weight of 343.39 g/mol. Its IUPAC name is (5Z)-5-[[5-(3H-pyrrolo[3,2-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(3H-pyrrolo[3,2-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 159123971 |
| Molecular Formula | C15H9N3O3S2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | (5Z)-5-[[5-(3H-pyrrolo[3,2-b]pyridin-2-ylsulfanyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(SC3=Nc4cccnc4C3)o2)S1 |
| InChI | InChI=1S/C15H9N3O3S2/c19-14-11(22-15(20)18-14)6-8-3-4-13(21-8)23-12-7-10-9(17-12)2-1-5-16-10/h1-6H,7H2,(H,18,19,20)/b11-6- |
| InChIKey | KGBABCNYHVNMQC-WDZFZDKYSA-N |
| XLogP | 3.38 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|