About benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine
benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine (PubChem CID 159124461) has the molecular formula C24H24F3N7O2
and a molecular weight of 499.50 g/mol. Its IUPAC name is benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine.
Molecular Properties
| Compound Name | benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine |
| PubChem CID | 159124461 |
| Molecular Formula | C24H24F3N7O2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine |
| SMILES | NCc1cccc(-n2nnnc2C(F)(F)F)c1.Nc1cccc(CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C15H16N2O2.C9H8F3N5/c16-14-8-4-7-13(9-14)10-17-15(18)19-11-12-5-2-1-3-6-12;10-9(11,12)8-14-15-16-17(8)7-3-1-2-6(4-7)5-13/h1-9H,10-11,16H2,(H,17,18);1-4H,5,13H2 |
| InChIKey | KGCMNVUUSXOXDE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine?
The IUPAC name of benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine (CID 159124461) is benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine.
What is the SMILES notation for benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine?
The canonical SMILES for benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine is NCc1cccc(-n2nnnc2C(F)(F)F)c1.Nc1cccc(CNC(=O)OCc2ccccc2)c1.
What is the InChIKey of benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine?
The InChIKey is KGCMNVUUSXOXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2.C9H8F3N5/c16-14-8-4-7-13(9-14)10-17-15(18)19-11-12-5-2-1-3-6-12;10-9(11,12)8-14-15-16-17(8)7-3-1-2-6(4-7)5-13/h1-9H,10-11,16H2,(H,17,18);1-4H,5,13H2.
What are the key properties of benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine?
benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine has a molecular weight of 499.50 g/mol, XLogP of 3.84, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(3-aminophenyl)methyl]carbamate;[3-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methanamine is sourced from PubChem (CID 159124461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).