About (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane
(4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane (PubChem CID 159126174) has the molecular formula C15H32N2O4
and a molecular weight of 304.43 g/mol. Its IUPAC name is (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane.
Molecular Properties
| Compound Name | (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane |
| PubChem CID | 159126174 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane |
| SMILES | CC(C)C.COCCN(C)C(=O)OCC1CC(OC)CN1 |
| InChI | InChI=1S/C11H22N2O4.C4H10/c1-13(4-5-15-2)11(14)17-8-9-6-10(16-3)7-12-9;1-4(2)3/h9-10,12H,4-8H2,1-3H3;4H,1-3H3 |
| InChIKey | KGHMVHPWVQPLKF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane?
The IUPAC name of (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane (CID 159126174) is (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane.
What is the SMILES notation for (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane?
The canonical SMILES for (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane is CC(C)C.COCCN(C)C(=O)OCC1CC(OC)CN1.
What is the InChIKey of (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane?
The InChIKey is KGHMVHPWVQPLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4.C4H10/c1-13(4-5-15-2)11(14)17-8-9-6-10(16-3)7-12-9;1-4(2)3/h9-10,12H,4-8H2,1-3H3;4H,1-3H3.
What are the key properties of (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane?
(4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane has a molecular weight of 304.43 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxypyrrolidin-2-yl)methyl N-(2-methoxyethyl)-N-methylcarbamate;2-methylpropane is sourced from PubChem (CID 159126174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).