C13H14FNO4 — CID 159126386
ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-2-oxopropanoate (PubChem CID 159126386) has the molecular formula C13H14FNO4 and a molecular weight of 267.26 g/mol. Its IUPAC name is ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-2-oxopropanoate.
| Compound Name | ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-2-oxopropanoate |
|---|---|
| PubChem CID | 159126386 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | ethyl 3-[[2-(4-fluorophenyl)acetyl]amino]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)CNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FNO4/c1-2-19-13(18)11(16)8-15-12(17)7-9-3-5-10(14)6-4-9/h3-6H,2,7-8H2,1H3,(H,15,17) |
| InChIKey | IJQBIEPKCDOTAI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|