C13H10BrCl2NO2S — CID 159127101
3-bromo-6-[(2,3-dichlorophenyl)sulfonylmethyl]-2-methylpyridine (PubChem CID 159127101) has the molecular formula C13H10BrCl2NO2S and a molecular weight of 395.11 g/mol. Its IUPAC name is 3-bromo-6-[(2,3-dichlorophenyl)sulfonylmethyl]-2-methylpyridine.
| Compound Name | 3-bromo-6-[(2,3-dichlorophenyl)sulfonylmethyl]-2-methylpyridine |
|---|---|
| PubChem CID | 159127101 |
| Molecular Formula | C13H10BrCl2NO2S |
| Molecular Weight | 395.11 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | 3-bromo-6-[(2,3-dichlorophenyl)sulfonylmethyl]-2-methylpyridine |
| SMILES | Cc1nc(CS(=O)(=O)c2cccc(Cl)c2Cl)ccc1Br |
| InChI | InChI=1S/C13H10BrCl2NO2S/c1-8-10(14)6-5-9(17-8)7-20(18,19)12-4-2-3-11(15)13(12)16/h2-6H,7H2,1H3 |
| InChIKey | JYXINWSMTMFCEA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.11 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |