About 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline
3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline (PubChem CID 159127201) has the molecular formula C16H20N4O2S2
and a molecular weight of 364.50 g/mol. Its IUPAC name is 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline.
Molecular Properties
| Compound Name | 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline |
| PubChem CID | 159127201 |
| Molecular Formula | C16H20N4O2S2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline |
| SMILES | Cc1cc2ncc(C#N)c(SCCCCNS(N)(=O)=O)c2cc1C |
| InChI | InChI=1S/C16H20N4O2S2/c1-11-7-14-15(8-12(11)2)19-10-13(9-17)16(14)23-6-4-3-5-20-24(18,21)22/h7-8,10,20H,3-6H2,1-2H3,(H2,18,21,22) |
| InChIKey | CFRRYSLLLQWRIJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline?
The IUPAC name of 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline (CID 159127201) is 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline.
What is the SMILES notation for 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline?
The canonical SMILES for 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline is Cc1cc2ncc(C#N)c(SCCCCNS(N)(=O)=O)c2cc1C.
What is the InChIKey of 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline?
The InChIKey is CFRRYSLLLQWRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O2S2/c1-11-7-14-15(8-12(11)2)19-10-13(9-17)16(14)23-6-4-3-5-20-24(18,21)22/h7-8,10,20H,3-6H2,1-2H3,(H2,18,21,22).
What are the key properties of 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline?
3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline has a molecular weight of 364.50 g/mol, XLogP of 2.39, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-6,7-dimethyl-4-[4-(sulfamoylamino)butylsulfanyl]quinoline is sourced from PubChem (CID 159127201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).