About tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate
tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate (PubChem CID 159127202) has the molecular formula C21H28N4O4S2
and a molecular weight of 464.61 g/mol. Its IUPAC name is tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate |
| PubChem CID | 159127202 |
| Molecular Formula | C21H28N4O4S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate |
| SMILES | Cc1cc2ncc(C#N)c(SCCCCNS(=O)(=O)NC(=O)OC(C)(C)C)c2cc1C |
| InChI | InChI=1S/C21H28N4O4S2/c1-14-10-17-18(11-15(14)2)23-13-16(12-22)19(17)30-9-7-6-8-24-31(27,28)25-20(26)29-21(3,4)5/h10-11,13,24H,6-9H2,1-5H3,(H,25,26) |
| InChIKey | HEEOMRCQHGXZNK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate?
The IUPAC name of tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate (CID 159127202) is tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate.
What is the SMILES notation for tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate?
The canonical SMILES for tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate is Cc1cc2ncc(C#N)c(SCCCCNS(=O)(=O)NC(=O)OC(C)(C)C)c2cc1C.
What is the InChIKey of tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate?
The InChIKey is HEEOMRCQHGXZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O4S2/c1-14-10-17-18(11-15(14)2)23-13-16(12-22)19(17)30-9-7-6-8-24-31(27,28)25-20(26)29-21(3,4)5/h10-11,13,24H,6-9H2,1-5H3,(H,25,26).
What are the key properties of tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate?
tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate has a molecular weight of 464.61 g/mol, XLogP of 3.95, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(3-cyano-6,7-dimethylquinolin-4-yl)sulfanylbutylsulfamoyl]carbamate is sourced from PubChem (CID 159127202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).