C52H32F6N4 — CID 159128303
3-[2,4-bis(trifluoromethyl)phenyl]-9-[6-[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(3-isocyanophenyl)-3-pyridinyl]carbazole (PubChem CID 159128303) has the molecular formula C52H32F6N4 and a molecular weight of 826.84 g/mol. Its IUPAC name is 3-[2,4-bis(trifluoromethyl)phenyl]-9-[6-[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(3-isocyanophenyl)-3-pyridinyl]carbazole.
| Compound Name | 3-[2,4-bis(trifluoromethyl)phenyl]-9-[6-[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(3-isocyanophenyl)-3-pyridinyl]carbazole |
|---|---|
| PubChem CID | 159128303 |
| Molecular Formula | C52H32F6N4 |
| Molecular Weight | 826.84 g/mol |
| Exact Mass | 826.25 |
| IUPAC Name | 3-[2,4-bis(trifluoromethyl)phenyl]-9-[6-[3-(2,4-dimethylphenyl)carbazol-9-yl]-4-(3-isocyanophenyl)-3-pyridinyl]carbazole |
| SMILES | [C-]#[N+]c1cccc(-c2cc(-n3c4ccccc4c4cc(-c5ccc(C)cc5C)ccc43)ncc2-n2c3ccccc3c3cc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C52H32F6N4/c1-30-15-19-37(31(2)23-30)33-16-22-48-43(25-33)40-12-5-7-14-46(40)62(48)50-28-41(32-9-8-10-36(24-32)59-3)49(29-60-50)61-45-13-6-4-11-39(45)42-26-34(17-21-47(42)61)38-20-18-35(51(53,54)55)27-44(38)52(56,57)58/h4-29H,1-2H3 |
| InChIKey | ZADNCSLOPWVDBC-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 27.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.84 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|