About 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium
1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium (PubChem CID 159128401) has the molecular formula C21H22F6NO5S2+
and a molecular weight of 546.53 g/mol. Its IUPAC name is 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium.
Molecular Properties
| Compound Name | 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium |
| PubChem CID | 159128401 |
| Molecular Formula | C21H22F6NO5S2+ |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium |
| SMILES | C[N+](C)(C)CC1CO1.O=S(=O)(c1ccc2c(c1S(=O)(=O)C(F)(F)F)Cc1ccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C15H8F6O4S2.C6H14NO/c16-14(17,18)26(22,23)12-6-5-10-9-4-2-1-3-8(9)7-11(10)13(12)27(24,25)15(19,20)21;1-7(2,3)4-6-5-8-6/h1-6H,7H2;6H,4-5H2,1-3H3/q;+1 |
| InChIKey | KGOLAVPOQDAXCL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium?
The IUPAC name of 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium (CID 159128401) is 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium.
What is the SMILES notation for 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium?
The canonical SMILES for 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium is C[N+](C)(C)CC1CO1.O=S(=O)(c1ccc2c(c1S(=O)(=O)C(F)(F)F)Cc1ccccc1-2)C(F)(F)F.
What is the InChIKey of 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium?
The InChIKey is KGOLAVPOQDAXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F6O4S2.C6H14NO/c16-14(17,18)26(22,23)12-6-5-10-9-4-2-1-3-8(9)7-11(10)13(12)27(24,25)15(19,20)21;1-7(2,3)4-6-5-8-6/h1-6H,7H2;6H,4-5H2,1-3H3/q;+1.
What are the key properties of 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium?
1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium has a molecular weight of 546.53 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;trimethyl(oxiran-2-ylmethyl)azanium is sourced from PubChem (CID 159128401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).