C17H20Si — CID 159129201
1,2,3,5,5-pentamethylbenzo[b][1]benzosilole (PubChem CID 159129201) has the molecular formula C17H20Si and a molecular weight of 252.43 g/mol. Its IUPAC name is 1,2,3,5,5-pentamethylbenzo[b][1]benzosilole.
| Compound Name | 1,2,3,5,5-pentamethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 159129201 |
| Molecular Formula | C17H20Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1,2,3,5,5-pentamethylbenzo[b][1]benzosilole |
| SMILES | Cc1cc2c(c(C)c1C)-c1ccccc1[Si]2(C)C |
| InChI | InChI=1S/C17H20Si/c1-11-10-16-17(13(3)12(11)2)14-8-6-7-9-15(14)18(16,4)5/h6-10H,1-5H3 |
| InChIKey | YDWCEMABAMWEPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|