C22H38 — CID 159129815
but-2-ene;2,3-dimethylbut-2-ene;1,2,3,4,5,6-hexamethylbenzene (PubChem CID 159129815) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is but-2-ene;2,3-dimethylbut-2-ene;1,2,3,4,5,6-hexamethylbenzene.
| Compound Name | but-2-ene;2,3-dimethylbut-2-ene;1,2,3,4,5,6-hexamethylbenzene |
|---|---|
| PubChem CID | 159129815 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | but-2-ene;2,3-dimethylbut-2-ene;1,2,3,4,5,6-hexamethylbenzene |
| SMILES | CC(C)=C(C)C.CC=CC.Cc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C12H18.C6H12.C4H8/c1-7-8(2)10(4)12(6)11(5)9(7)3;1-5(2)6(3)4;1-3-4-2/h1-6H3;1-4H3;3-4H,1-2H3 |
| InChIKey | KGSXOPLZFXMQSD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|