About 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid
7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid (PubChem CID 159130143) has the molecular formula C21H15ClFN3O3
and a molecular weight of 411.82 g/mol. Its IUPAC name is 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid |
| PubChem CID | 159130143 |
| Molecular Formula | C21H15ClFN3O3 |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2ccccc2c1.O=c1ccn(C2CC2)c2nc(Cl)c(F)cc12 |
| InChI | InChI=1S/C11H8ClFN2O.C10H7NO2/c12-10-8(13)5-7-9(16)3-4-15(6-1-2-6)11(7)14-10;12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h3-6H,1-2H2;1-6H,(H,12,13) |
| InChIKey | KGUAJDPIMKYEQQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid?
The IUPAC name of 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid (CID 159130143) is 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid.
What is the SMILES notation for 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid?
The canonical SMILES for 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid is O=C(O)c1cnc2ccccc2c1.O=c1ccn(C2CC2)c2nc(Cl)c(F)cc12.
What is the InChIKey of 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid?
The InChIKey is KGUAJDPIMKYEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O.C10H7NO2/c12-10-8(13)5-7-9(16)3-4-15(6-1-2-6)11(7)14-10;12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h3-6H,1-2H2;1-6H,(H,12,13).
What are the key properties of 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid?
7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid has a molecular weight of 411.82 g/mol, XLogP of 4.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-cyclopropyl-6-fluoro-1,8-naphthyridin-4-one;quinoline-3-carboxylic acid is sourced from PubChem (CID 159130143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).