About N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane
N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane (PubChem CID 159130335) has the molecular formula C22H28BNO
and a molecular weight of 333.28 g/mol. Its IUPAC name is N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane.
Molecular Properties
| Compound Name | N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane |
| PubChem CID | 159130335 |
| Molecular Formula | C22H28BNO |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane |
| SMILES | C.Cc1ccc(B(OCCN(C)C)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C21H24BNO.CH4/c1-17-11-13-19(14-12-17)22(24-16-15-23(2)3)21-10-6-8-18-7-4-5-9-20(18)21;/h4-14H,15-16H2,1-3H3;1H4 |
| InChIKey | KGUQMUDZOVQGQZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane?
The IUPAC name of N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane (CID 159130335) is N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane.
What is the SMILES notation for N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane?
The canonical SMILES for N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane is C.Cc1ccc(B(OCCN(C)C)c2cccc3ccccc23)cc1.
What is the InChIKey of N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane?
The InChIKey is KGUQMUDZOVQGQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BNO.CH4/c1-17-11-13-19(14-12-17)22(24-16-15-23(2)3)21-10-6-8-18-7-4-5-9-20(18)21;/h4-14H,15-16H2,1-3H3;1H4.
What are the key properties of N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane?
N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane has a molecular weight of 333.28 g/mol, XLogP of 3.47, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-[(4-methylphenyl)-naphthalen-1-ylboranyl]oxyethanamine;methane is sourced from PubChem (CID 159130335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).