C11H14N2 — CID 159130491
2,3,5,7-tetramethyl-6H-cyclopenta[b]pyrazine (PubChem CID 159130491) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,5,7-tetramethyl-6H-cyclopenta[b]pyrazine.
| Compound Name | 2,3,5,7-tetramethyl-6H-cyclopenta[b]pyrazine |
|---|---|
| PubChem CID | 159130491 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,5,7-tetramethyl-6H-cyclopenta[b]pyrazine |
| SMILES | CC1=c2nc(C)c(C)nc2=C(C)C1 |
| InChI | InChI=1S/C11H14N2/c1-6-5-7(2)11-10(6)12-8(3)9(4)13-11/h5H2,1-4H3 |
| InChIKey | PHLZZSLQUFAOSK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |