About 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole
3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole (PubChem CID 159130894) has the molecular formula C10H8F3NO2S2
and a molecular weight of 295.31 g/mol. Its IUPAC name is 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole |
| PubChem CID | 159130894 |
| Molecular Formula | C10H8F3NO2S2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole |
| SMILES | Cc1ccsc1C(=O)O.FC(F)(F)c1cscn1 |
| InChI | InChI=1S/C6H6O2S.C4H2F3NS/c1-4-2-3-9-5(4)6(7)8;5-4(6,7)3-1-9-2-8-3/h2-3H,1H3,(H,7,8);1-2H |
| InChIKey | KGWLTBYVULLNQF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole?
The IUPAC name of 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole (CID 159130894) is 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole.
What is the SMILES notation for 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole?
The canonical SMILES for 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole is Cc1ccsc1C(=O)O.FC(F)(F)c1cscn1.
What is the InChIKey of 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole?
The InChIKey is KGWLTBYVULLNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S.C4H2F3NS/c1-4-2-3-9-5(4)6(7)8;5-4(6,7)3-1-9-2-8-3/h2-3H,1H3,(H,7,8);1-2H.
What are the key properties of 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole?
3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole has a molecular weight of 295.31 g/mol, XLogP of 3.92, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylthiophene-2-carboxylic acid;4-(trifluoromethyl)-1,3-thiazole is sourced from PubChem (CID 159130894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).