About methane;thiazinane 1,1-dioxide
methane;thiazinane 1,1-dioxide (PubChem CID 159130961) has the molecular formula C5H13NO2S
and a molecular weight of 151.23 g/mol. Its IUPAC name is methane;thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | methane;thiazinane 1,1-dioxide |
| PubChem CID | 159130961 |
| Molecular Formula | C5H13NO2S |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | methane;thiazinane 1,1-dioxide |
| SMILES | C.O=S1(=O)CCCCN1 |
| InChI | InChI=1S/C4H9NO2S.CH4/c6-8(7)4-2-1-3-5-8;/h5H,1-4H2;1H4 |
| InChIKey | KGWRUKWPZFGKSW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;thiazinane 1,1-dioxide?
The IUPAC name of methane;thiazinane 1,1-dioxide (CID 159130961) is methane;thiazinane 1,1-dioxide.
What is the SMILES notation for methane;thiazinane 1,1-dioxide?
The canonical SMILES for methane;thiazinane 1,1-dioxide is C.O=S1(=O)CCCCN1.
What is the InChIKey of methane;thiazinane 1,1-dioxide?
The InChIKey is KGWRUKWPZFGKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2S.CH4/c6-8(7)4-2-1-3-5-8;/h5H,1-4H2;1H4.
What are the key properties of methane;thiazinane 1,1-dioxide?
methane;thiazinane 1,1-dioxide has a molecular weight of 151.23 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;thiazinane 1,1-dioxide is sourced from PubChem (CID 159130961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).