About 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one
1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one (PubChem CID 159130997) has the molecular formula C25H24Cl2N2O
and a molecular weight of 439.39 g/mol. Its IUPAC name is 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one.
Molecular Properties
| Compound Name | 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one |
| PubChem CID | 159130997 |
| Molecular Formula | C25H24Cl2N2O |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CCc1nc(-c2ccc(Cl)cc2)ccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O/c26-20-9-5-18(6-10-20)22-13-14-23(19-7-11-21(27)12-8-19)28-24(22)15-17-29-16-3-1-2-4-25(29)30/h5-14H,1-4,15-17H2 |
| InChIKey | KGWVBAGJVGCYKM-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one?
The IUPAC name of 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one (CID 159130997) is 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one.
What is the SMILES notation for 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one?
The canonical SMILES for 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one is O=C1CCCCCN1CCc1nc(-c2ccc(Cl)cc2)ccc1-c1ccc(Cl)cc1.
What is the InChIKey of 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one?
The InChIKey is KGWVBAGJVGCYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24Cl2N2O/c26-20-9-5-18(6-10-20)22-13-14-23(19-7-11-21(27)12-8-19)28-24(22)15-17-29-16-3-1-2-4-25(29)30/h5-14H,1-4,15-17H2.
What are the key properties of 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one?
1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one has a molecular weight of 439.39 g/mol, XLogP of 6.67, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[3,6-bis(4-chlorophenyl)-2-pyridinyl]ethyl]azepan-2-one is sourced from PubChem (CID 159130997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).