About N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine
N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine (PubChem CID 159132271) has the molecular formula C12H10BrN5S
and a molecular weight of 336.22 g/mol. Its IUPAC name is N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine |
| PubChem CID | 159132271 |
| Molecular Formula | C12H10BrN5S |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine |
| SMILES | [C-]#[N+]c1nc(C2CC2)sc1Nc1ncc(Br)c(C)n1 |
| InChI | InChI=1S/C12H10BrN5S/c1-6-8(13)5-15-12(16-6)18-11-9(14-2)17-10(19-11)7-3-4-7/h5,7H,3-4H2,1H3,(H,15,16,18) |
| InChIKey | QCOFOWYFMKYBLF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine?
The IUPAC name of N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine (CID 159132271) is N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine.
What is the SMILES notation for N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine?
The canonical SMILES for N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine is [C-]#[N+]c1nc(C2CC2)sc1Nc1ncc(Br)c(C)n1.
What is the InChIKey of N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine?
The InChIKey is QCOFOWYFMKYBLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN5S/c1-6-8(13)5-15-12(16-6)18-11-9(14-2)17-10(19-11)7-3-4-7/h5,7H,3-4H2,1H3,(H,15,16,18).
What are the key properties of N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine?
N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine has a molecular weight of 336.22 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-4-methylpyrimidin-2-yl)-2-cyclopropyl-4-isocyano-1,3-thiazol-5-amine is sourced from PubChem (CID 159132271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).