C24H26F3NO9 — CID 159135206
(2R)-4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-hydroxy-4-oxobutanoic acid;2,2,2-trifluoroacetaldehyde (PubChem CID 159135206) has the molecular formula C24H26F3NO9 and a molecular weight of 529.46 g/mol. Its IUPAC name is (2R)-4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-hydroxy-4-oxobutanoic acid;2,2,2-trifluoroacetaldehyde.
| Compound Name | (2R)-4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-hydroxy-4-oxobutanoic acid;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159135206 |
| Molecular Formula | C24H26F3NO9 |
| Molecular Weight | 529.46 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | (2R)-4-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-hydroxy-4-oxobutanoic acid;2,2,2-trifluoroacetaldehyde |
| SMILES | COc1ccc2c3c1O[C@H]1C(OC(=O)C[C@@H](O)C(=O)O)=CC[C@@]4(O)[C@@H](C2)N(C)CC[C@]314.O=CC(F)(F)F |
| InChI | InChI=1S/C22H25NO8.C2HF3O/c1-23-8-7-21-17-11-3-4-13(29-2)18(17)31-19(21)14(5-6-22(21,28)15(23)9-11)30-16(25)10-12(24)20(26)27;3-2(4,5)1-6/h3-5,12,15,19,24,28H,6-10H2,1-2H3,(H,26,27);1H/t12-,15-,19+,21+,22-;/m1./s1 |
| InChIKey | KHKBIJWOAQAIJB-YEHROBERSA-N |
| XLogP | 1.10 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|