C28H22BBrF6N2O8 — CID 159135339
1-bromo-4-nitro-2-(trifluoromethyl)benzene;(4-methoxyphenyl)boronic acid;1-(4-methoxyphenyl)-4-nitro-2-(trifluoromethyl)benzene (PubChem CID 159135339) has the molecular formula C28H22BBrF6N2O8 and a molecular weight of 719.19 g/mol. Its IUPAC name is 1-bromo-4-nitro-2-(trifluoromethyl)benzene;(4-methoxyphenyl)boronic acid;1-(4-methoxyphenyl)-4-nitro-2-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-4-nitro-2-(trifluoromethyl)benzene;(4-methoxyphenyl)boronic acid;1-(4-methoxyphenyl)-4-nitro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 159135339 |
| Molecular Formula | C28H22BBrF6N2O8 |
| Molecular Weight | 719.19 g/mol |
| Exact Mass | 718.06 |
| IUPAC Name | 1-bromo-4-nitro-2-(trifluoromethyl)benzene;(4-methoxyphenyl)boronic acid;1-(4-methoxyphenyl)-4-nitro-2-(trifluoromethyl)benzene |
| SMILES | COc1ccc(-c2ccc([N+](=O)[O-])cc2C(F)(F)F)cc1.COc1ccc(B(O)O)cc1.O=[N+]([O-])c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F3NO3.C7H9BO3.C7H3BrF3NO2/c1-21-11-5-2-9(3-6-11)12-7-4-10(18(19)20)8-13(12)14(15,16)17;1-11-7-4-2-6(3-5-7)8(9)10;8-6-2-1-4(12(13)14)3-5(6)7(9,10)11/h2-8H,1H3;2-5,9-10H,1H3;1-3H |
| InChIKey | KHKNOCGUECGAKN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.19 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|