C10H14O3S — CID 15913578
4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbothioic S-acid (PubChem CID 15913578) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbothioic S-acid.
| Compound Name | 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbothioic S-acid |
|---|---|
| PubChem CID | 15913578 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbothioic S-acid |
| SMILES | CC12CCC(C(=O)S)(OC1=O)C2(C)C |
| InChI | InChI=1S/C10H14O3S/c1-8(2)9(3)4-5-10(8,7(12)14)13-6(9)11/h4-5H2,1-3H3,(H,12,14) |
| InChIKey | DXYLGBOPUPAYRK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|