C40H72N4 — CID 159136598
1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine (PubChem CID 159136598) has the molecular formula C40H72N4 and a molecular weight of 609.04 g/mol. Its IUPAC name is 1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 159136598 |
| Molecular Formula | C40H72N4 |
| Molecular Weight | 609.04 g/mol |
| Exact Mass | 608.58 |
| IUPAC Name | 1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine |
| SMILES | CC(C)CCC(C)Nc1ccc(NC(C)CCC(C)C)cc1.CC(C)CCC(C)Nc1ccc(NC(C)CCC(C)C)cc1 |
| InChI | InChI=1S/2C20H36N2/c2*1-15(2)7-9-17(5)21-19-11-13-20(14-12-19)22-18(6)10-8-16(3)4/h2*11-18,21-22H,7-10H2,1-6H3 |
| InChIKey | KHOKEEVGTYZQGG-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.04 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |