About N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine
N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine (PubChem CID 159137270) has the molecular formula C24H41N3
and a molecular weight of 371.61 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine.
Molecular Properties
| Compound Name | N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine |
| PubChem CID | 159137270 |
| Molecular Formula | C24H41N3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.33 |
| IUPAC Name | N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine |
| SMILES | CCCCCCCCCCNC(C)C1CC1.NCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H31N.C9H10N2/c1-3-4-5-6-7-8-9-10-13-16-14(2)15-11-12-15;10-6-8-5-7-3-1-2-4-9(7)11-8/h14-16H,3-13H2,1-2H3;1-5,11H,6,10H2 |
| InChIKey | KHQNOQAXLIRSIN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine?
The IUPAC name of N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine (CID 159137270) is N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine.
What is the SMILES notation for N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine?
The canonical SMILES for N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine is CCCCCCCCCCNC(C)C1CC1.NCc1cc2ccccc2[nH]1.
What is the InChIKey of N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine?
The InChIKey is KHQNOQAXLIRSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N.C9H10N2/c1-3-4-5-6-7-8-9-10-13-16-14(2)15-11-12-15;10-6-8-5-7-3-1-2-4-9(7)11-8/h14-16H,3-13H2,1-2H3;1-5,11H,6,10H2.
What are the key properties of N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine?
N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine has a molecular weight of 371.61 g/mol, XLogP of 6.14, 12 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylethyl)decan-1-amine;1H-indol-2-ylmethanamine is sourced from PubChem (CID 159137270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).