C16H25NO8 — CID 159137546
acetic acid;(2R,3R,4R,5S,6R)-2-(4-aminophenyl)-6-(hydroxymethyl)-4,5-dimethoxyoxane-2,3-diol (PubChem CID 159137546) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is acetic acid;(2R,3R,4R,5S,6R)-2-(4-aminophenyl)-6-(hydroxymethyl)-4,5-dimethoxyoxane-2,3-diol.
| Compound Name | acetic acid;(2R,3R,4R,5S,6R)-2-(4-aminophenyl)-6-(hydroxymethyl)-4,5-dimethoxyoxane-2,3-diol |
|---|---|
| PubChem CID | 159137546 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | acetic acid;(2R,3R,4R,5S,6R)-2-(4-aminophenyl)-6-(hydroxymethyl)-4,5-dimethoxyoxane-2,3-diol |
| SMILES | CC(=O)O.CO[C@@H]1[C@H](OC)[C@@H](O)[C@@](O)(c2ccc(N)cc2)O[C@@H]1CO |
| InChI | InChI=1S/C14H21NO6.C2H4O2/c1-19-11-10(7-16)21-14(18,13(17)12(11)20-2)8-3-5-9(15)6-4-8;1-2(3)4/h3-6,10-13,16-18H,7,15H2,1-2H3;1H3,(H,3,4)/t10-,11+,12+,13-,14-;/m1./s1 |
| InChIKey | ROFCQAYXSZHNLX-YZODCAOUSA-N |
| XLogP | -0.71 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|