C25H26O3Si — CID 15913766
1-[[(E)-1,2-bis(4-methoxyphenyl)ethenyl]-methyl-phenylsilyl]ethanone (PubChem CID 15913766) has the molecular formula C25H26O3Si and a molecular weight of 402.57 g/mol. Its IUPAC name is 1-[[(E)-1,2-bis(4-methoxyphenyl)ethenyl]-methyl-phenylsilyl]ethanone.
| Compound Name | 1-[[(E)-1,2-bis(4-methoxyphenyl)ethenyl]-methyl-phenylsilyl]ethanone |
|---|---|
| PubChem CID | 15913766 |
| Molecular Formula | C25H26O3Si |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[[(E)-1,2-bis(4-methoxyphenyl)ethenyl]-methyl-phenylsilyl]ethanone |
| SMILES | COc1ccc(/C=C(\c2ccc(OC)cc2)[Si](C)(C(C)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26O3Si/c1-19(26)29(4,24-8-6-5-7-9-24)25(21-12-16-23(28-3)17-13-21)18-20-10-14-22(27-2)15-11-20/h5-18H,1-4H3/b25-18+ |
| InChIKey | VNXAMYUCFGWPKJ-XIEYBQDHSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|