C27H26F3N5O7S2 — CID 159137740
(2S)-2-[4-(2-cyanophenyl)anilino]-3-(3-methanehydrazonoylphenyl)-N,N-bis(methylsulfonyl)propanamide;2,2,2-trifluoroacetic acid (PubChem CID 159137740) has the molecular formula C27H26F3N5O7S2 and a molecular weight of 653.66 g/mol. Its IUPAC name is (2S)-2-[4-(2-cyanophenyl)anilino]-3-(3-methanehydrazonoylphenyl)-N,N-bis(methylsulfonyl)propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[4-(2-cyanophenyl)anilino]-3-(3-methanehydrazonoylphenyl)-N,N-bis(methylsulfonyl)propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159137740 |
| Molecular Formula | C27H26F3N5O7S2 |
| Molecular Weight | 653.66 g/mol |
| Exact Mass | 653.12 |
| IUPAC Name | (2S)-2-[4-(2-cyanophenyl)anilino]-3-(3-methanehydrazonoylphenyl)-N,N-bis(methylsulfonyl)propanamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N(C(=O)[C@H](Cc1cccc(C=NN)c1)Nc1ccc(-c2ccccc2C#N)cc1)S(C)(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H25N5O5S2.C2HF3O2/c1-36(32,33)30(37(2,34)35)25(31)24(15-18-6-5-7-19(14-18)17-28-27)29-22-12-10-20(11-13-22)23-9-4-3-8-21(23)16-26;3-2(4,5)1(6)7/h3-14,17,24,29H,15,27H2,1-2H3;(H,6,7)/t24-;/m0./s1 |
| InChIKey | KHSDBIFDNTWXFT-JIDHJSLPSA-N |
| XLogP | 2.92 |
| TPSA | 200.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|