C34H52BBrN6O6 — CID 159138615
tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 159138615) has the molecular formula C34H52BBrN6O6 and a molecular weight of 731.54 g/mol. Its IUPAC name is tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159138615 |
| Molecular Formula | C34H52BBrN6O6 |
| Molecular Weight | 731.54 g/mol |
| Exact Mass | 730.32 |
| IUPAC Name | tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)CC1.CC(C)(C)OC(=O)N1CCN(c2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C20H32BN3O4.C14H20BrN3O2/c1-18(2,3)26-17(25)24-12-10-23(11-13-24)16-9-8-15(14-22-16)21-27-19(4,5)20(6,7)28-21;1-14(2,3)20-13(19)18-8-6-17(7-9-18)12-5-4-11(15)10-16-12/h8-9,14H,10-13H2,1-7H3;4-5,10H,6-9H2,1-3H3 |
| InChIKey | KHUXFQLOJHJGMS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|