C41H29N5O2S — CID 159139937
5-[9-(benzenesulfonyl)-6-pyrido[4,3-b]indol-5-ylcarbazol-3-yl]pyrido[4,3-b]indole;methane (PubChem CID 159139937) has the molecular formula C41H29N5O2S and a molecular weight of 655.78 g/mol. Its IUPAC name is 5-[9-(benzenesulfonyl)-6-pyrido[4,3-b]indol-5-ylcarbazol-3-yl]pyrido[4,3-b]indole;methane.
| Compound Name | 5-[9-(benzenesulfonyl)-6-pyrido[4,3-b]indol-5-ylcarbazol-3-yl]pyrido[4,3-b]indole;methane |
|---|---|
| PubChem CID | 159139937 |
| Molecular Formula | C41H29N5O2S |
| Molecular Weight | 655.78 g/mol |
| Exact Mass | 655.20 |
| IUPAC Name | 5-[9-(benzenesulfonyl)-6-pyrido[4,3-b]indol-5-ylcarbazol-3-yl]pyrido[4,3-b]indole;methane |
| SMILES | C.O=S(=O)(c1ccccc1)n1c2ccc(-n3c4ccccc4c4cnccc43)cc2c2cc(-n3c4ccccc4c4cnccc43)ccc21 |
| InChI | InChI=1S/C40H25N5O2S.CH4/c46-48(47,28-8-2-1-3-9-28)45-39-16-14-26(43-35-12-6-4-10-29(35)33-24-41-20-18-37(33)43)22-31(39)32-23-27(15-17-40(32)45)44-36-13-7-5-11-30(36)34-25-42-21-19-38(34)44;/h1-25H;1H4 |
| InChIKey | KHYWCTXAFSQNHA-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.78 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |