C16H22Cl2 — CID 159140622
(3aR,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene;hydrochloride (PubChem CID 159140622) has the molecular formula C16H22Cl2 and a molecular weight of 285.26 g/mol. Its IUPAC name is (3aR,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene;hydrochloride.
| Compound Name | (3aR,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene;hydrochloride |
|---|---|
| PubChem CID | 159140622 |
| Molecular Formula | C16H22Cl2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (3aR,9bR)-6-chloro-7-ethyl-3a-methyl-1,2,3,4,5,9b-hexahydrocyclopenta[a]naphthalene;hydrochloride |
| SMILES | CCc1ccc2c(c1Cl)CC[C@@]1(C)CCC[C@@H]21.Cl |
| InChI | InChI=1S/C16H21Cl.ClH/c1-3-11-6-7-12-13(15(11)17)8-10-16(2)9-4-5-14(12)16;/h6-7,14H,3-5,8-10H2,1-2H3;1H/t14-,16+;/m0./s1 |
| InChIKey | VJLKZAGDZNUMTR-KUARMEPBSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |