About methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole
methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole (PubChem CID 159141644) has the molecular formula C24H39N5
and a molecular weight of 397.61 g/mol. Its IUPAC name is methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole.
Molecular Properties
| Compound Name | methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole |
| PubChem CID | 159141644 |
| Molecular Formula | C24H39N5 |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole |
| SMILES | C.C.C.C.c1c[nH]c(-c2ccc[nH]2)c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1 |
| InChI | InChI=1S/C8H8N2.3C4H5N.4CH4/c1-3-7(9-5-1)8-4-2-6-10-8;3*1-2-4-5-3-1;;;;/h1-6,9-10H;3*1-5H;4*1H4 |
| InChIKey | KIDVYGDQRLEODL-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole?
The IUPAC name of methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole (CID 159141644) is methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole.
What is the SMILES notation for methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole?
The canonical SMILES for methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole is C.C.C.C.c1c[nH]c(-c2ccc[nH]2)c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.
What is the InChIKey of methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole?
The InChIKey is KIDVYGDQRLEODL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.3C4H5N.4CH4/c1-3-7(9-5-1)8-4-2-6-10-8;3*1-2-4-5-3-1;;;;/h1-6,9-10H;3*1-5H;4*1H4.
What are the key properties of methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole?
methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole has a molecular weight of 397.61 g/mol, XLogP of 7.60, 1 rotatable bonds, 5 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;tris(1H-pyrrole);2-(1H-pyrrol-2-yl)-1H-pyrrole is sourced from PubChem (CID 159141644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).