C17H22F11NO — CID 159141753
4-methyl-1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propyl]piperidine (PubChem CID 159141753) has the molecular formula C17H22F11NO and a molecular weight of 465.35 g/mol. Its IUPAC name is 4-methyl-1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propyl]piperidine.
| Compound Name | 4-methyl-1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propyl]piperidine |
|---|---|
| PubChem CID | 159141753 |
| Molecular Formula | C17H22F11NO |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 4-methyl-1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]propyl]piperidine |
| SMILES | CC1CCN(C(F)C(F)(C2CCCC(C(F)(F)C(F)C(F)(F)F)O2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H22F11NO/c1-9-5-7-29(8-6-9)13(19)14(20,17(26,27)28)10-3-2-4-11(30-10)15(21,22)12(18)16(23,24)25/h9-13H,2-8H2,1H3 |
| InChIKey | IOULUMFDXGHVLF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|