About methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate
methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate (PubChem CID 15914243) has the molecular formula C9H12N4O6
and a molecular weight of 272.22 g/mol. Its IUPAC name is methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate |
| PubChem CID | 15914243 |
| Molecular Formula | C9H12N4O6 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(NCC(O)CO)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O6/c1-19-9(16)7-8(13(17)18)11-3-6(12-7)10-2-5(15)4-14/h3,5,14-15H,2,4H2,1H3,(H,10,12) |
| InChIKey | LQIAEAOIFUAQMZ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate?
The IUPAC name of methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate (CID 15914243) is methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate?
The canonical SMILES for methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate is COC(=O)c1nc(NCC(O)CO)cnc1[N+](=O)[O-].
What is the InChIKey of methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate?
The InChIKey is LQIAEAOIFUAQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O6/c1-19-9(16)7-8(13(17)18)11-3-6(12-7)10-2-5(15)4-14/h3,5,14-15H,2,4H2,1H3,(H,10,12).
What are the key properties of methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate?
methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate has a molecular weight of 272.22 g/mol, XLogP of -1.06, 6 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(2,3-dihydroxypropylamino)-3-nitropyrazine-2-carboxylate is sourced from PubChem (CID 15914243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).