C10H18F3NO2S — CID 159142905
1-tert-butyl-3-(2,2,2-trifluoroethylsulfonylmethyl)azetidine (PubChem CID 159142905) has the molecular formula C10H18F3NO2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,2,2-trifluoroethylsulfonylmethyl)azetidine.
| Compound Name | 1-tert-butyl-3-(2,2,2-trifluoroethylsulfonylmethyl)azetidine |
|---|---|
| PubChem CID | 159142905 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-tert-butyl-3-(2,2,2-trifluoroethylsulfonylmethyl)azetidine |
| SMILES | CC(C)(C)N1CC(CS(=O)(=O)CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3NO2S/c1-9(2,3)14-4-8(5-14)6-17(15,16)7-10(11,12)13/h8H,4-7H2,1-3H3 |
| InChIKey | JXOPOOPCQFFJNY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |