C35H43F2O8S2+ — CID 159143000
[4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-phenyl-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium (PubChem CID 159143000) has the molecular formula C35H43F2O8S2+ and a molecular weight of 693.85 g/mol. Its IUPAC name is [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-phenyl-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium.
| Compound Name | [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-phenyl-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 159143000 |
| Molecular Formula | C35H43F2O8S2+ |
| Molecular Weight | 693.85 g/mol |
| Exact Mass | 693.24 |
| IUPAC Name | [4-[2-(1,1-difluoro-1-sulfopropan-2-yl)oxyacetyl]oxy-3,5-dimethylphenyl]-phenyl-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccc(C3(C)OCC(C)(C)C(C(C)C)O3)cc2)cc(C)c1OC(=O)COC(C)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C35H42F2O8S2/c1-22(2)32-33(6,7)21-43-34(8,45-32)26-14-16-28(17-15-26)46(27-12-10-9-11-13-27)29-18-23(3)31(24(4)19-29)44-30(38)20-42-25(5)35(36,37)47(39,40)41/h9-19,22,25,32H,20-21H2,1-8H3/p+1 |
| InChIKey | JSBUQHQAYLSZTG-UHFFFAOYSA-O |
| XLogP | 7.46 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.85 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|