C32H35IrN4O2S- — CID 159143144
3-(3H-1-benzothiophen-3-id-2-yl)-2-methylpyrazino[2,3-b]quinoxaline;3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 159143144) has the molecular formula C32H35IrN4O2S- and a molecular weight of 731.94 g/mol. Its IUPAC name is 3-(3H-1-benzothiophen-3-id-2-yl)-2-methylpyrazino[2,3-b]quinoxaline;3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 3-(3H-1-benzothiophen-3-id-2-yl)-2-methylpyrazino[2,3-b]quinoxaline;3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 159143144 |
| Molecular Formula | C32H35IrN4O2S- |
| Molecular Weight | 731.94 g/mol |
| Exact Mass | 732.21 |
| IUPAC Name | 3-(3H-1-benzothiophen-3-id-2-yl)-2-methylpyrazino[2,3-b]quinoxaline;3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)C=C(O)C(CC)CC.Cc1nc2nc3ccccc3nc2nc1-c1[c-]c2ccccc2s1.[Ir] |
| InChI | InChI=1S/C19H11N4S.C13H24O2.Ir/c1-11-17(16-10-12-6-2-5-9-15(12)24-16)23-19-18(20-11)21-13-7-3-4-8-14(13)22-19;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h2-9H,1H3;9-11,14H,5-8H2,1-4H3;/q-1;; |
| InChIKey | ZVNASRVYIGCPNO-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.94 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|