About dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane
dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane (PubChem CID 159143305) has the molecular formula C28H26S2Si
and a molecular weight of 454.74 g/mol. Its IUPAC name is dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane.
Molecular Properties
| Compound Name | dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane |
| PubChem CID | 159143305 |
| Molecular Formula | C28H26S2Si |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane |
| SMILES | Cc1cccc2c1sc1c([Si](C)(C)C)cccc12.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C16H18SSi.C12H8S/c1-11-7-5-8-12-13-9-6-10-14(18(2,3)4)16(13)17-15(11)12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h5-10H,1-4H3;1-8H |
| InChIKey | KIJBRQNSCWNMTC-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane?
The IUPAC name of dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane (CID 159143305) is dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane.
What is the SMILES notation for dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane?
The canonical SMILES for dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane is Cc1cccc2c1sc1c([Si](C)(C)C)cccc12.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane?
The InChIKey is KIJBRQNSCWNMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18SSi.C12H8S/c1-11-7-5-8-12-13-9-6-10-14(18(2,3)4)16(13)17-15(11)12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h5-10H,1-4H3;1-8H.
What are the key properties of dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane?
dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane has a molecular weight of 454.74 g/mol, XLogP of 8.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene;trimethyl-(6-methyldibenzothiophen-4-yl)silane is sourced from PubChem (CID 159143305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).