C7H10F5N — CID 15914333
(Z)-N,N-diethyl-1,2,3,3,3-pentafluoroprop-1-en-1-amine (PubChem CID 15914333) has the molecular formula C7H10F5N and a molecular weight of 203.15 g/mol. Its IUPAC name is (Z)-N,N-diethyl-1,2,3,3,3-pentafluoroprop-1-en-1-amine.
| Compound Name | (Z)-N,N-diethyl-1,2,3,3,3-pentafluoroprop-1-en-1-amine |
|---|---|
| PubChem CID | 15914333 |
| Molecular Formula | C7H10F5N |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (Z)-N,N-diethyl-1,2,3,3,3-pentafluoroprop-1-en-1-amine |
| SMILES | CCN(CC)/C(F)=C(/F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5N/c1-3-13(4-2)6(9)5(8)7(10,11)12/h3-4H2,1-2H3/b6-5+ |
| InChIKey | ZSCCHUVVXJRWAE-AATRIKPKSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|