About N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol
N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol (PubChem CID 159144844) has the molecular formula C11H27NO
and a molecular weight of 189.34 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol |
| PubChem CID | 159144844 |
| Molecular Formula | C11H27NO |
| Molecular Weight | 189.34 g/mol |
| Exact Mass | 189.21 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol |
| SMILES | CC(C)O.CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C8H19N.C3H8O/c1-6-9(7(2)3)8(4)5;1-3(2)4/h7-8H,6H2,1-5H3;3-4H,1-2H3 |
| InChIKey | KINZKQQNPHHPEJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol?
The IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol (CID 159144844) is N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol.
What is the SMILES notation for N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol?
The canonical SMILES for N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol is CC(C)O.CCN(C(C)C)C(C)C.
What is the InChIKey of N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol?
The InChIKey is KINZKQQNPHHPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H8O/c1-6-9(7(2)3)8(4)5;1-3(2)4/h7-8H,6H2,1-5H3;3-4H,1-2H3.
What are the key properties of N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol?
N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol has a molecular weight of 189.34 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylpropan-2-amine;propan-2-ol is sourced from PubChem (CID 159144844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).