About 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium
4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium (PubChem CID 159145288) has the molecular formula C16H13I2NO2V
and a molecular weight of 556.04 g/mol. Its IUPAC name is 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium.
Molecular Properties
| Compound Name | 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium |
| PubChem CID | 159145288 |
| Molecular Formula | C16H13I2NO2V |
| Molecular Weight | 556.04 g/mol |
| Exact Mass | 555.85 |
| IUPAC Name | 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium |
| SMILES | CC(=O)c1cccc(COc2ccc(C#N)cc2)c1.I[V]I |
| InChI | InChI=1S/C16H13NO2.2HI.V/c1-12(18)15-4-2-3-14(9-15)11-19-16-7-5-13(10-17)6-8-16;;;/h2-9H,11H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KIPKSAGLIDYVHB-UHFFFAOYSA-L |
| XLogP | 5.11 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.04 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium?
The IUPAC name of 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium (CID 159145288) is 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium.
What is the SMILES notation for 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium?
The canonical SMILES for 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium is CC(=O)c1cccc(COc2ccc(C#N)cc2)c1.I[V]I.
What is the InChIKey of 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium?
The InChIKey is KIPKSAGLIDYVHB-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H13NO2.2HI.V/c1-12(18)15-4-2-3-14(9-15)11-19-16-7-5-13(10-17)6-8-16;;;/h2-9H,11H2,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium?
4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium has a molecular weight of 556.04 g/mol, XLogP of 5.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-acetylphenyl)methoxy]benzonitrile;diiodovanadium is sourced from PubChem (CID 159145288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).