C21H30N2OS — CID 159147742
(3R,5S)-3,5-dimethyl-1-[3-(1-thiophen-2-ylpentoxy)phenyl]piperazine (PubChem CID 159147742) has the molecular formula C21H30N2OS and a molecular weight of 358.55 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-1-[3-(1-thiophen-2-ylpentoxy)phenyl]piperazine.
| Compound Name | (3R,5S)-3,5-dimethyl-1-[3-(1-thiophen-2-ylpentoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 159147742 |
| Molecular Formula | C21H30N2OS |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-1-[3-(1-thiophen-2-ylpentoxy)phenyl]piperazine |
| SMILES | CCCCC(Oc1cccc(N2C[C@@H](C)N[C@@H](C)C2)c1)c1cccs1 |
| InChI | InChI=1S/C21H30N2OS/c1-4-5-10-20(21-11-7-12-25-21)24-19-9-6-8-18(13-19)23-14-16(2)22-17(3)15-23/h6-9,11-13,16-17,20,22H,4-5,10,14-15H2,1-3H3/t16-,17+,20? |
| InChIKey | KIXAXWSJIZXLFC-XEWABKELSA-N |
| XLogP | 5.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |