About [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide
[amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide (PubChem CID 159147985) has the molecular formula C8H21IN2O2S
and a molecular weight of 336.24 g/mol. Its IUPAC name is [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide.
Molecular Properties
| Compound Name | [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide |
| PubChem CID | 159147985 |
| Molecular Formula | C8H21IN2O2S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide |
| SMILES | CCOCS(C)(COCC)C(N)=[NH2+].[I-] |
| InChI | InChI=1S/C8H20N2O2S.HI/c1-4-11-6-13(3,8(9)10)7-12-5-2;/h4-7H2,1-3H3,(H3,9,10);1H |
| InChIKey | KIXSJJDQZMSIBW-UHFFFAOYSA-N |
| XLogP | -3.51 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide?
The IUPAC name of [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide (CID 159147985) is [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide.
What is the SMILES notation for [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide?
The canonical SMILES for [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide is CCOCS(C)(COCC)C(N)=[NH2+].[I-].
What is the InChIKey of [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide?
The InChIKey is KIXSJJDQZMSIBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2S.HI/c1-4-11-6-13(3,8(9)10)7-12-5-2;/h4-7H2,1-3H3,(H3,9,10);1H.
What are the key properties of [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide?
[amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide has a molecular weight of 336.24 g/mol, XLogP of -3.51, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [amino-[bis(ethoxymethyl)-methyl-λ4-sulfanyl]methylidene]azanium iodide is sourced from PubChem (CID 159147985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).