C24H34N2O6S2 — CID 159148968
(3aS,6aR)-2,2-dimethyl-5-(5-methyl-1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-ol (PubChem CID 159148968) has the molecular formula C24H34N2O6S2 and a molecular weight of 510.68 g/mol. Its IUPAC name is (3aS,6aR)-2,2-dimethyl-5-(5-methyl-1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-ol.
| Compound Name | (3aS,6aR)-2,2-dimethyl-5-(5-methyl-1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-ol |
|---|---|
| PubChem CID | 159148968 |
| Molecular Formula | C24H34N2O6S2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (3aS,6aR)-2,2-dimethyl-5-(5-methyl-1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-ol |
| SMILES | Cc1cnc(C2(O)C[C@@H]3OC(C)(C)O[C@@H]3C2)s1.Cc1cnc(C2(O)C[C@@H]3OC(C)(C)O[C@@H]3C2)s1 |
| InChI | InChI=1S/2C12H17NO3S/c2*1-7-6-13-10(17-7)12(14)4-8-9(5-12)16-11(2,3)15-8/h2*6,8-9,14H,4-5H2,1-3H3/t2*8-,9+,12? |
| InChIKey | KJAQDOLFFREWCQ-ZLSSEPPRSA-N |
| XLogP | 3.91 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |