C15H11F2IN2O2 — CID 159149420
2-[4-(1-ethyl-5-iodo-6-oxo-2-pyridinyl)-3,5-difluorophenoxy]acetonitrile (PubChem CID 159149420) has the molecular formula C15H11F2IN2O2 and a molecular weight of 416.17 g/mol. Its IUPAC name is 2-[4-(1-ethyl-5-iodo-6-oxo-2-pyridinyl)-3,5-difluorophenoxy]acetonitrile.
| Compound Name | 2-[4-(1-ethyl-5-iodo-6-oxo-2-pyridinyl)-3,5-difluorophenoxy]acetonitrile |
|---|---|
| PubChem CID | 159149420 |
| Molecular Formula | C15H11F2IN2O2 |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 2-[4-(1-ethyl-5-iodo-6-oxo-2-pyridinyl)-3,5-difluorophenoxy]acetonitrile |
| SMILES | CCn1c(-c2c(F)cc(OCC#N)cc2F)ccc(I)c1=O |
| InChI | InChI=1S/C15H11F2IN2O2/c1-2-20-13(4-3-12(18)15(20)21)14-10(16)7-9(8-11(14)17)22-6-5-19/h3-4,7-8H,2,6H2,1H3 |
| InChIKey | NXPHENOJDPHARK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|