About diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride
diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride (PubChem CID 15915) has the molecular formula C15H27ClN2O
and a molecular weight of 286.85 g/mol. Its IUPAC name is diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride.
Molecular Properties
| Compound Name | diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride |
| PubChem CID | 15915 |
| Molecular Formula | C15H27ClN2O |
| Molecular Weight | 286.85 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride |
| SMILES | CC[NH+](CC)CCN1C(=O)C(C)C=C(C)C=C1C.[Cl-] |
| InChI | InChI=1S/C15H26N2O.ClH/c1-6-16(7-2)8-9-17-14(5)11-12(3)10-13(4)15(17)18;/h10-11,13H,6-9H2,1-5H3;1H |
| InChIKey | QQCLHCPSXXRWGT-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.85 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride?
The IUPAC name of diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride (CID 15915) is diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride.
What is the SMILES notation for diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride?
The canonical SMILES for diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride is CC[NH+](CC)CCN1C(=O)C(C)C=C(C)C=C1C.[Cl-].
What is the InChIKey of diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride?
The InChIKey is QQCLHCPSXXRWGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O.ClH/c1-6-16(7-2)8-9-17-14(5)11-12(3)10-13(4)15(17)18;/h10-11,13H,6-9H2,1-5H3;1H.
What are the key properties of diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride?
diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride has a molecular weight of 286.85 g/mol, XLogP of -1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-[2-(3,5,7-trimethyl-2-oxo-3H-azepin-1-yl)ethyl]azanium chloride is sourced from PubChem (CID 15915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).