C37H32N4O2S3 — CID 159151695
4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N,N-dimethylbenzamide;bis(hepta-1,2,3,4,5,6-hexaene) (PubChem CID 159151695) has the molecular formula C37H32N4O2S3 and a molecular weight of 660.89 g/mol. Its IUPAC name is 4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N,N-dimethylbenzamide;bis(hepta-1,2,3,4,5,6-hexaene).
| Compound Name | 4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N,N-dimethylbenzamide;bis(hepta-1,2,3,4,5,6-hexaene) |
|---|---|
| PubChem CID | 159151695 |
| Molecular Formula | C37H32N4O2S3 |
| Molecular Weight | 660.89 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | 4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]-N,N-dimethylbenzamide;bis(hepta-1,2,3,4,5,6-hexaene) |
| SMILES | C=C=C=C=C=C=C.C=C=C=C=C=C=C.CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(C(=O)N(C)C)cc3)c2c1N |
| InChI | InChI=1S/C23H24N4O2S3.2C7H4/c1-4-5-12-32(29)23-19(24)18-16(14-6-8-15(9-7-14)22(28)27(2)3)13-17(26-21(18)31-23)20-25-10-11-30-20;2*1-3-5-7-6-4-2/h6-11,13H,4-5,12,24H2,1-3H3;2*1-2H2 |
| InChIKey | KJJLQYJWQKNDQQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.89 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |