C26H36F2N6O10 — CID 159152249
[(2S,3R,4R,5R)-2-acetyloxy-4,5-dimethyloxolan-3-yl] acetate;[(2R,3R,4R,5R)-2-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4,5-dimethyloxolan-3-yl] acetate;6-amino-5-fluoro-1H-pyrimidin-2-one (PubChem CID 159152249) has the molecular formula C26H36F2N6O10 and a molecular weight of 630.60 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-acetyloxy-4,5-dimethyloxolan-3-yl] acetate;[(2R,3R,4R,5R)-2-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4,5-dimethyloxolan-3-yl] acetate;6-amino-5-fluoro-1H-pyrimidin-2-one.
| Compound Name | [(2S,3R,4R,5R)-2-acetyloxy-4,5-dimethyloxolan-3-yl] acetate;[(2R,3R,4R,5R)-2-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4,5-dimethyloxolan-3-yl] acetate;6-amino-5-fluoro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 159152249 |
| Molecular Formula | C26H36F2N6O10 |
| Molecular Weight | 630.60 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | [(2S,3R,4R,5R)-2-acetyloxy-4,5-dimethyloxolan-3-yl] acetate;[(2R,3R,4R,5R)-2-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4,5-dimethyloxolan-3-yl] acetate;6-amino-5-fluoro-1H-pyrimidin-2-one |
| SMILES | CC(=O)O[C@@H]1O[C@H](C)[C@@H](C)[C@H]1OC(C)=O.CC(=O)O[C@@H]1[C@H](C)[C@@H](C)O[C@H]1n1cc(F)c(N)nc1=O.Nc1[nH]c(=O)ncc1F |
| InChI | InChI=1S/C12H16FN3O4.C10H16O5.C4H4FN3O/c1-5-6(2)19-11(9(5)20-7(3)17)16-4-8(13)10(14)15-12(16)18;1-5-6(2)13-10(15-8(4)12)9(5)14-7(3)11;5-2-1-7-4(9)8-3(2)6/h4-6,9,11H,1-3H3,(H2,14,15,18);5-6,9-10H,1-4H3;1H,(H3,6,7,8,9)/t5-,6-,9-,11-;5-,6-,9-,10+;/m11./s1 |
| InChIKey | KJLGYBIWCGNZQD-CNJIIOKLSA-N |
| XLogP | 0.80 |
| TPSA | 230.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.60 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|