C18H26O8 — CID 159152878
[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-pentoxybenzoate (PubChem CID 159152878) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is [(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-pentoxybenzoate.
| Compound Name | [(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-pentoxybenzoate |
|---|---|
| PubChem CID | 159152878 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 2-pentoxybenzoate |
| SMILES | CCCCCOc1ccccc1C(=O)OCC1O[C@H](O)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26O8/c1-2-3-6-9-24-12-8-5-4-7-11(12)17(22)25-10-13-14(19)15(20)16(21)18(23)26-13/h4-5,7-8,13-16,18-21,23H,2-3,6,9-10H2,1H3/t13?,14-,15+,16?,18+/m1/s1 |
| InChIKey | KJNHUULDLUXNQI-DGVDHHCRSA-N |
| XLogP | 0.21 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|