C44H40N8+4 — CID 159154038
5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-1,20,21,23-tetrahydroporphyrin (PubChem CID 159154038) has the molecular formula C44H40N8+4 and a molecular weight of 680.86 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-1,20,21,23-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-1,20,21,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 159154038 |
| Molecular Formula | C44H40N8+4 |
| Molecular Weight | 680.86 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | 5,10,15,20-tetrakis(1-methylpyridin-1-ium-4-yl)-1,20,21,23-tetrahydroporphyrin |
| SMILES | C[n+]1ccc(C2=C3C=CC(N3)C(c3cc[n+](C)cc3)C3=NC(=C(c4cc[n+](C)cc4)c4ccc([nH]4)C(c4cc[n+](C)cc4)=C4C=CC2=N4)C=C3)cc1 |
| InChI | InChI=1S/C44H39N8/c1-49-21-13-29(14-22-49)41-33-5-7-35(45-33)42(30-15-23-50(2)24-16-30)37-9-11-39(47-37)44(32-19-27-52(4)28-20-32)40-12-10-38(48-40)43(36-8-6-34(41)46-36)31-17-25-51(3)26-18-31/h5-28,33,41H,1-4H3,(H,46,47,48)/q+3/p+1 |
| InChIKey | IRLNILUWMSKWKT-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|