C34H52N12O2 — CID 159154178
carbanide;(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)-[4-[5-[4-[(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-3-methoxyphenyl]-1,5-diazocan-1-yl]-2-methoxyphenyl]diazene (PubChem CID 159154178) has the molecular formula C34H52N12O2 and a molecular weight of 660.87 g/mol. Its IUPAC name is carbanide;(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)-[4-[5-[4-[(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-3-methoxyphenyl]-1,5-diazocan-1-yl]-2-methoxyphenyl]diazene.
| Compound Name | carbanide;(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)-[4-[5-[4-[(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-3-methoxyphenyl]-1,5-diazocan-1-yl]-2-methoxyphenyl]diazene |
|---|---|
| PubChem CID | 159154178 |
| Molecular Formula | C34H52N12O2 |
| Molecular Weight | 660.87 g/mol |
| Exact Mass | 660.43 |
| IUPAC Name | carbanide;(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)-[4-[5-[4-[(2,4-diethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-3-methoxyphenyl]-1,5-diazocan-1-yl]-2-methoxyphenyl]diazene |
| SMILES | CCn1nc[n+](CC)c1/N=N/c1ccc(N2CCCN(c3ccc(/N=N/c4n(CC)nc[n+]4CC)c(OC)c3)CCC2)cc1OC.[CH3-].[CH3-] |
| InChI | InChI=1S/C32H46N12O2.2CH3/c1-7-39-23-33-43(9-3)31(39)37-35-27-15-13-25(21-29(27)45-5)41-17-11-19-42(20-12-18-41)26-14-16-28(30(22-26)46-6)36-38-32-40(8-2)24-34-44(32)10-4;;/h13-16,21-24H,7-12,17-20H2,1-6H3;2*1H3/q+2;2*-1 |
| InChIKey | KJRIBABWIBDTFT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 117.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.87 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|