C45H47BrN4O6S2 — CID 159154435
3-bromo-5-(2-methoxyphenyl)-1,2,4-thiadiazole;2,2-diethyl-6-[5-(2-methoxyphenyl)-1,2,4-thiadiazol-3-yl]-3H-chromen-4-one;2,2-diethyl-6-methyl-3H-chromen-4-one (PubChem CID 159154435) has the molecular formula C45H47BrN4O6S2 and a molecular weight of 883.93 g/mol. Its IUPAC name is 3-bromo-5-(2-methoxyphenyl)-1,2,4-thiadiazole;2,2-diethyl-6-[5-(2-methoxyphenyl)-1,2,4-thiadiazol-3-yl]-3H-chromen-4-one;2,2-diethyl-6-methyl-3H-chromen-4-one.
| Compound Name | 3-bromo-5-(2-methoxyphenyl)-1,2,4-thiadiazole;2,2-diethyl-6-[5-(2-methoxyphenyl)-1,2,4-thiadiazol-3-yl]-3H-chromen-4-one;2,2-diethyl-6-methyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 159154435 |
| Molecular Formula | C45H47BrN4O6S2 |
| Molecular Weight | 883.93 g/mol |
| Exact Mass | 882.21 |
| IUPAC Name | 3-bromo-5-(2-methoxyphenyl)-1,2,4-thiadiazole;2,2-diethyl-6-[5-(2-methoxyphenyl)-1,2,4-thiadiazol-3-yl]-3H-chromen-4-one;2,2-diethyl-6-methyl-3H-chromen-4-one |
| SMILES | CCC1(CC)CC(=O)c2cc(-c3nsc(-c4ccccc4OC)n3)ccc2O1.CCC1(CC)CC(=O)c2cc(C)ccc2O1.COc1ccccc1-c1nc(Br)ns1 |
| InChI | InChI=1S/C22H22N2O3S.C14H18O2.C9H7BrN2OS/c1-4-22(5-2)13-17(25)16-12-14(10-11-19(16)27-22)20-23-21(28-24-20)15-8-6-7-9-18(15)26-3;1-4-14(5-2)9-12(15)11-8-10(3)6-7-13(11)16-14;1-13-7-5-3-2-4-6(7)8-11-9(10)12-14-8/h6-12H,4-5,13H2,1-3H3;6-8H,4-5,9H2,1-3H3;2-5H,1H3 |
| InChIKey | KJSDJDPWODBLKS-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 122.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.93 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |